KI+Pb(N03)2 > PBI2+ KNO3 how many molecules of potassium (KNO3) nitrate are produced when 6.57 moles of lead (ll) nitrate (Pb(NO3)2) reacts?
Solved
Show answers
More tips
- H Health and Medicine What to Do When Your Jaw Locks Up?...
- G Goods and services What Are the Most Popular Services?...
- P Philosophy How did the concept of module arise in computer science?...
- D Dating, Love, Relationships Why Should the Man be Active and the Woman Passive during Foreplay?...
- S Society and Politics Выборы: Смысл, Значение и Отражение...
- B Business and Finance How to Get Your Money Back When Lending? Top 7 Ways...
- F Family and Home Do Lullabies Help Babies Sleep or Is it Just a Myth?...
- F Family and Home Why Does God Punish Us Constantly and How Can We Fix It?...
- D Dating, Love, Relationships Why do we feel shame?...
- S Society and Politics How Could Nobody Know About the Dead Mountaineers?...
Answers on questions: Chemistry
- C Chemistry What is the ph of a 0.051 m solution of hcl?...
- C Chemistry Explain collision theory and discuss how it can be used to explain why powdered sugar will dissolve in water faster than a cube of sugar....
- C Chemistry Use the data in the table to answer the following. how many grand if bromine reaches? how many grams of compound were formed?...
- C Chemistry What is responsible for the difference in climate between eastern and western california a-california has experienced a drastic climate change in past few year b-cool winds cannot...
- C Chemistry The pressure and temperature of 10 liters of gas are doubled. if the original condition are 2 atmosphere of pressure and 400k what is the final volume...
- C Chemistry What method can be used to separate mixtures...
- C Chemistry Hey, so i am having some difficulty answering this question. i wasn’t really paying attention in class because it was very confusing. anyway, i’m trying to find the number in the...
- C Chemistry Entropy, the degree of disorder is related to the number of configurations that a system can adopt. If the entropy of a system is 71.85 J/mole*K, the number of configurations possible...
- C Chemistry Determine the number of hydrogen atoms connected to each carbon atom: The bond-line structure of a compound has a SMILES string of CC1CCN(CC1N(C)C2=NC=NC3=C2C=CN3)C(=O)CC#N. All...
- M Mathematics The Lagan family bought a $150,000 home in 2002. They obtained a mortgage loan for 30 years. The monthly payments, not including property taxes and insurance, are $895.00. Assuming...
Ответ:
homosapiens is the species we all belong to or which humans belong to.
Explanation:
Can i have brainliest pl